C15H26N4 — CID 166539018
(1Z,3E)-N-butyl-1-[(E)-2-iminoethylideneamino]-4-(methylideneamino)-N-(2-methylpropyl)buta-1,3-dien-1-amine (PubChem CID 166539018) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is (1Z,3E)-N-butyl-1-[(E)-2-iminoethylideneamino]-4-(methylideneamino)-N-(2-methylpropyl)buta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N-butyl-1-[(E)-2-iminoethylideneamino]-4-(methylideneamino)-N-(2-methylpropyl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 166539018 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | (1Z,3E)-N-butyl-1-[(E)-2-iminoethylideneamino]-4-(methylideneamino)-N-(2-methylpropyl)buta-1,3-dien-1-amine |
| SMILES | [H]/N=C/C=N/C(=C\C=C\N=C)N(CCCC)CC(C)C |
| InChI | InChI=1S/C15H26N4/c1-5-6-12-19(13-14(2)3)15(18-11-9-16)8-7-10-17-4/h7-11,14,16H,4-6,12-13H2,1-3H3/b10-7+,15-8+,16-9+,18-11+ |
| InChIKey | QMAGYPBDHMWFGZ-DKNLOTIKSA-N |
| XLogP | 3.52 |
| TPSA | 51.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|