C11H16N2O8P2+2 — CID 121329854
[4-[(4-aminobenzoyl)amino]-1-hydroxy-1-[hydroxy(oxo)phosphaniumyl]oxybutoxy]-hydroxy-oxophosphanium (PubChem CID 121329854) has the molecular formula C11H16N2O8P2+2 and a molecular weight of 366.20 g/mol. Its IUPAC name is [4-[(4-aminobenzoyl)amino]-1-hydroxy-1-[hydroxy(oxo)phosphaniumyl]oxybutoxy]-hydroxy-oxophosphanium.
| Compound Name | [4-[(4-aminobenzoyl)amino]-1-hydroxy-1-[hydroxy(oxo)phosphaniumyl]oxybutoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 121329854 |
| Molecular Formula | C11H16N2O8P2+2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | [4-[(4-aminobenzoyl)amino]-1-hydroxy-1-[hydroxy(oxo)phosphaniumyl]oxybutoxy]-hydroxy-oxophosphanium |
| SMILES | Nc1ccc(C(=O)NCCCC(O)(O[P+](=O)O)O[P+](=O)O)cc1 |
| InChI | InChI=1S/C11H14N2O8P2/c12-9-4-2-8(3-5-9)10(14)13-7-1-6-11(15,20-22(16)17)21-23(18)19/h2-5,15H,1,6-7H2,(H3-2,12,13,14,16,17,18,19)/p+2 |
| InChIKey | TVWGKQCBOWDZNU-UHFFFAOYSA-P |
| XLogP | 0.76 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|