About (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide
(Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide (PubChem CID 121330197) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide.
Molecular Properties
| Compound Name | (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide |
| PubChem CID | 121330197 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide |
| SMILES | CCNC(=O)C/C=C\N1C(C)=CC(C)=NC1C |
| InChI | InChI=1S/C13H21N3O/c1-5-14-13(17)7-6-8-16-11(3)9-10(2)15-12(16)4/h6,8-9,12H,5,7H2,1-4H3,(H,14,17)/b8-6- |
| InChIKey | MVGSONRILVYWHC-VURMDHGXSA-N |
| XLogP | 2.05 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide?
The IUPAC name of (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide (CID 121330197) is (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide.
What is the SMILES notation for (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide?
The canonical SMILES for (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide is CCNC(=O)C/C=C\N1C(C)=CC(C)=NC1C.
What is the InChIKey of (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide?
The InChIKey is MVGSONRILVYWHC-VURMDHGXSA-N. The full InChI is InChI=1S/C13H21N3O/c1-5-14-13(17)7-6-8-16-11(3)9-10(2)15-12(16)4/h6,8-9,12H,5,7H2,1-4H3,(H,14,17)/b8-6-.
What are the key properties of (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide?
(Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide has a molecular weight of 235.33 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethyl-4-(2,4,6-trimethyl-2H-pyrimidin-1-yl)but-3-enamide is sourced from PubChem (CID 121330197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).