About methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate
methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate (PubChem CID 121334128) has the molecular formula C23H21N3O4
and a molecular weight of 403.44 g/mol. Its IUPAC name is methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate |
| PubChem CID | 121334128 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate |
| SMILES | COC(=O)c1cc2[nH]c(=O)cc(NCc3ccccc3)c2cc1-c1c(C)noc1C |
| InChI | InChI=1S/C23H21N3O4/c1-13-22(14(2)30-26-13)16-9-18-19(24-12-15-7-5-4-6-8-15)11-21(27)25-20(18)10-17(16)23(28)29-3/h4-11H,12H2,1-3H3,(H2,24,25,27) |
| InChIKey | SOTQZKFDQCUQBB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate?
The IUPAC name of methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate (CID 121334128) is methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate.
What is the SMILES notation for methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate?
The canonical SMILES for methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate is COC(=O)c1cc2[nH]c(=O)cc(NCc3ccccc3)c2cc1-c1c(C)noc1C.
What is the InChIKey of methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate?
The InChIKey is SOTQZKFDQCUQBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O4/c1-13-22(14(2)30-26-13)16-9-18-19(24-12-15-7-5-4-6-8-15)11-21(27)25-20(18)10-17(16)23(28)29-3/h4-11H,12H2,1-3H3,(H2,24,25,27).
What are the key properties of methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate?
methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate has a molecular weight of 403.44 g/mol, XLogP of 4.20, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(benzylamino)-6-(3,5-dimethyl-1,2-oxazol-4-yl)-2-oxo-1H-quinoline-7-carboxylate is sourced from PubChem (CID 121334128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).