C12H22FN — CID 121337291
(3S)-3-tert-butyl-6-fluoro-8-methyl-8-azabicyclo[3.2.1]octane (PubChem CID 121337291) has the molecular formula C12H22FN and a molecular weight of 199.31 g/mol. Its IUPAC name is (3S)-3-tert-butyl-6-fluoro-8-methyl-8-azabicyclo[3.2.1]octane.
| Compound Name | (3S)-3-tert-butyl-6-fluoro-8-methyl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 121337291 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (3S)-3-tert-butyl-6-fluoro-8-methyl-8-azabicyclo[3.2.1]octane |
| SMILES | CN1C2CC(F)C1C[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C12H22FN/c1-12(2,3)8-5-9-7-10(13)11(6-8)14(9)4/h8-11H,5-7H2,1-4H3/t8-,9?,10?,11?/m0/s1 |
| InChIKey | ADJHPSMGXJNINN-FBAUCUACSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |