C7H4BrN2O2S- — CID 121342948
6-bromoimidazo[1,2-a]pyridine-3-sulfinate (PubChem CID 121342948) has the molecular formula C7H4BrN2O2S- and a molecular weight of 260.09 g/mol. Its IUPAC name is 6-bromoimidazo[1,2-a]pyridine-3-sulfinate.
| Compound Name | 6-bromoimidazo[1,2-a]pyridine-3-sulfinate |
|---|---|
| PubChem CID | 121342948 |
| Molecular Formula | C7H4BrN2O2S- |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.92 |
| IUPAC Name | 6-bromoimidazo[1,2-a]pyridine-3-sulfinate |
| SMILES | O=S([O-])c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C7H5BrN2O2S/c8-5-1-2-6-9-3-7(13(11)12)10(6)4-5/h1-4H,(H,11,12)/p-1 |
| InChIKey | AVECKMGGTHDUPJ-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 57.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|