About 6-bromoimidazo[1,2-a]pyridine-3-sulfinate
6-bromoimidazo[1,2-a]pyridine-3-sulfinate (PubChem CID 121342948) has the molecular formula C7H4BrN2O2S-
and a molecular weight of 260.09 g/mol. Its IUPAC name is 6-bromoimidazo[1,2-a]pyridine-3-sulfinate.
Molecular Properties
| Compound Name | 6-bromoimidazo[1,2-a]pyridine-3-sulfinate |
| PubChem CID | 121342948 |
| Molecular Formula | C7H4BrN2O2S- |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 258.92 |
| IUPAC Name | 6-bromoimidazo[1,2-a]pyridine-3-sulfinate |
| SMILES | O=S([O-])c1cnc2ccc(Br)cn12 |
| InChI | InChI=1S/C7H5BrN2O2S/c8-5-1-2-6-9-3-7(13(11)12)10(6)4-5/h1-4H,(H,11,12)/p-1 |
| InChIKey | AVECKMGGTHDUPJ-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 57.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 6-bromoimidazo[1,2-a]pyridine-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromoimidazo[1,2-a]pyridine-3-sulfinate?
The IUPAC name of 6-bromoimidazo[1,2-a]pyridine-3-sulfinate (CID 121342948) is 6-bromoimidazo[1,2-a]pyridine-3-sulfinate.
What is the SMILES notation for 6-bromoimidazo[1,2-a]pyridine-3-sulfinate?
The canonical SMILES for 6-bromoimidazo[1,2-a]pyridine-3-sulfinate is O=S([O-])c1cnc2ccc(Br)cn12.
What is the InChIKey of 6-bromoimidazo[1,2-a]pyridine-3-sulfinate?
The InChIKey is AVECKMGGTHDUPJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5BrN2O2S/c8-5-1-2-6-9-3-7(13(11)12)10(6)4-5/h1-4H,(H,11,12)/p-1.
What are the key properties of 6-bromoimidazo[1,2-a]pyridine-3-sulfinate?
6-bromoimidazo[1,2-a]pyridine-3-sulfinate has a molecular weight of 260.09 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromoimidazo[1,2-a]pyridine-3-sulfinate is sourced from PubChem (CID 121342948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).