About [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate
[5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate (PubChem CID 121347123) has the molecular formula C17H21N3O5
and a molecular weight of 347.37 g/mol. Its IUPAC name is [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate.
Molecular Properties
| Compound Name | [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate |
| PubChem CID | 121347123 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate |
| SMILES | O=C(NN1CCCOC1=O)Oc1ccc(C2CC2)c(OCC2CC2)n1 |
| InChI | InChI=1S/C17H21N3O5/c21-16(19-20-8-1-9-23-17(20)22)25-14-7-6-13(12-4-5-12)15(18-14)24-10-11-2-3-11/h6-7,11-12H,1-5,8-10H2,(H,19,21) |
| InChIKey | LVIPSSJKGYLIMW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate?
The IUPAC name of [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate (CID 121347123) is [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate.
What is the SMILES notation for [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate?
The canonical SMILES for [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate is O=C(NN1CCCOC1=O)Oc1ccc(C2CC2)c(OCC2CC2)n1.
What is the InChIKey of [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate?
The InChIKey is LVIPSSJKGYLIMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O5/c21-16(19-20-8-1-9-23-17(20)22)25-14-7-6-13(12-4-5-12)15(18-14)24-10-11-2-3-11/h6-7,11-12H,1-5,8-10H2,(H,19,21).
What are the key properties of [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate?
[5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate has a molecular weight of 347.37 g/mol, XLogP of 2.59, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-cyclopropyl-6-(cyclopropylmethoxy)-2-pyridinyl] N-(2-oxo-1,3-oxazinan-3-yl)carbamate is sourced from PubChem (CID 121347123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).