C19H28N4O3 — CID 68569946
[6-(cyclopropylmethoxy)-5-pyrrolidin-1-ylpyrazin-2-yl] N-cyclohexylcarbamate (PubChem CID 68569946) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is [6-(cyclopropylmethoxy)-5-pyrrolidin-1-ylpyrazin-2-yl] N-cyclohexylcarbamate.
| Compound Name | [6-(cyclopropylmethoxy)-5-pyrrolidin-1-ylpyrazin-2-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 68569946 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | [6-(cyclopropylmethoxy)-5-pyrrolidin-1-ylpyrazin-2-yl] N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)Oc1cnc(N2CCCC2)c(OCC2CC2)n1 |
| InChI | InChI=1S/C19H28N4O3/c24-19(21-15-6-2-1-3-7-15)26-16-12-20-17(23-10-4-5-11-23)18(22-16)25-13-14-8-9-14/h12,14-15H,1-11,13H2,(H,21,24) |
| InChIKey | KIIRGESZKSBHSJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |