C19H28N3O5+ — CID 66837943
[4-[(1-hydroxypyridin-1-ium-4-yl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate (PubChem CID 66837943) has the molecular formula C19H28N3O5+ and a molecular weight of 378.45 g/mol. Its IUPAC name is [4-[(1-hydroxypyridin-1-ium-4-yl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate.
| Compound Name | [4-[(1-hydroxypyridin-1-ium-4-yl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66837943 |
| Molecular Formula | C19H28N3O5+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [4-[(1-hydroxypyridin-1-ium-4-yl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate |
| SMILES | O=C(NC1CCC(COC(=O)N2CCCC2)CC1)OCc1cc[n+](O)cc1 |
| InChI | InChI=1S/C19H27N3O5/c23-18(26-13-16-7-11-22(25)12-8-16)20-17-5-3-15(4-6-17)14-27-19(24)21-9-1-2-10-21/h7-8,11-12,15,17H,1-6,9-10,13-14H2,(H-,20,23,25)/p+1 |
| InChIKey | CNYAYVQAUWPSPC-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|