C19H26ClN3O4 — CID 56952294
[4-[(6-chloro-2-pyridinyl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate (PubChem CID 56952294) has the molecular formula C19H26ClN3O4 and a molecular weight of 395.89 g/mol. Its IUPAC name is [4-[(6-chloro-2-pyridinyl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate.
| Compound Name | [4-[(6-chloro-2-pyridinyl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 56952294 |
| Molecular Formula | C19H26ClN3O4 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [4-[(6-chloro-2-pyridinyl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate |
| SMILES | O=C(NC1CCC(COC(=O)N2CCCC2)CC1)OCc1cccc(Cl)n1 |
| InChI | InChI=1S/C19H26ClN3O4/c20-17-5-3-4-16(21-17)13-26-18(24)22-15-8-6-14(7-9-15)12-27-19(25)23-10-1-2-11-23/h3-5,14-15H,1-2,6-13H2,(H,22,24) |
| InChIKey | QINBRCJWGVIZBW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|