C19H26N2O5 — CID 56952291
[4-(pyridin-2-ylmethoxycarbonyloxy)cyclohexyl]methyl pyrrolidine-1-carboxylate (PubChem CID 56952291) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is [4-(pyridin-2-ylmethoxycarbonyloxy)cyclohexyl]methyl pyrrolidine-1-carboxylate.
| Compound Name | [4-(pyridin-2-ylmethoxycarbonyloxy)cyclohexyl]methyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 56952291 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [4-(pyridin-2-ylmethoxycarbonyloxy)cyclohexyl]methyl pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccn1)OC1CCC(COC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C19H26N2O5/c22-18(21-11-3-4-12-21)24-13-15-6-8-17(9-7-15)26-19(23)25-14-16-5-1-2-10-20-16/h1-2,5,10,15,17H,3-4,6-9,11-14H2 |
| InChIKey | FVQZKERIYFRXQZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |