C19H27N3O5 — CID 56952392
[4-[(1-oxidopyridin-1-ium-3-yl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate (PubChem CID 56952392) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-[(1-oxidopyridin-1-ium-3-yl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate.
| Compound Name | [4-[(1-oxidopyridin-1-ium-3-yl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 56952392 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [4-[(1-oxidopyridin-1-ium-3-yl)methoxycarbonylamino]cyclohexyl]methyl pyrrolidine-1-carboxylate |
| SMILES | O=C(NC1CCC(COC(=O)N2CCCC2)CC1)OCc1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C19H27N3O5/c23-18(26-14-16-4-3-11-22(25)12-16)20-17-7-5-15(6-8-17)13-27-19(24)21-9-1-2-10-21/h3-4,11-12,15,17H,1-2,5-10,13-14H2,(H,20,23) |
| InChIKey | JMFSZVCFAPVNMC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|