C18H26N2O4 — CID 121347296
[5-cyclopropyl-6-(oxolan-2-ylmethoxy)-2-pyridinyl] N-tert-butylcarbamate (PubChem CID 121347296) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is [5-cyclopropyl-6-(oxolan-2-ylmethoxy)-2-pyridinyl] N-tert-butylcarbamate.
| Compound Name | [5-cyclopropyl-6-(oxolan-2-ylmethoxy)-2-pyridinyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 121347296 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [5-cyclopropyl-6-(oxolan-2-ylmethoxy)-2-pyridinyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)Oc1ccc(C2CC2)c(OCC2CCCO2)n1 |
| InChI | InChI=1S/C18H26N2O4/c1-18(2,3)20-17(21)24-15-9-8-14(12-6-7-12)16(19-15)23-11-13-5-4-10-22-13/h8-9,12-13H,4-7,10-11H2,1-3H3,(H,20,21) |
| InChIKey | DBQSTJZPPKLYSD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |