C19H21N3O6S — CID 90202406
N-[3-(2-amino-2-oxoethyl)-2,4-dioxothietan-3-yl]-5-cyclopropyl-6-(oxolan-2-ylmethoxy)pyridine-2-carboxamide (PubChem CID 90202406) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is N-[3-(2-amino-2-oxoethyl)-2,4-dioxothietan-3-yl]-5-cyclopropyl-6-(oxolan-2-ylmethoxy)pyridine-2-carboxamide.
| Compound Name | N-[3-(2-amino-2-oxoethyl)-2,4-dioxothietan-3-yl]-5-cyclopropyl-6-(oxolan-2-ylmethoxy)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90202406 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[3-(2-amino-2-oxoethyl)-2,4-dioxothietan-3-yl]-5-cyclopropyl-6-(oxolan-2-ylmethoxy)pyridine-2-carboxamide |
| SMILES | NC(=O)CC1(NC(=O)c2ccc(C3CC3)c(OCC3CCCO3)n2)C(=O)SC1=O |
| InChI | InChI=1S/C19H21N3O6S/c20-14(23)8-19(17(25)29-18(19)26)22-15(24)13-6-5-12(10-3-4-10)16(21-13)28-9-11-2-1-7-27-11/h5-6,10-11H,1-4,7-9H2,(H2,20,23)(H,22,24) |
| InChIKey | RDWIXJKOKDEYHE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|