C19H29N3O4 — CID 47065380
N-(tert-butylcarbamoyl)-2-[4-(oxolan-2-ylmethoxy)anilino]propanamide (PubChem CID 47065380) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-[4-(oxolan-2-ylmethoxy)anilino]propanamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-[4-(oxolan-2-ylmethoxy)anilino]propanamide |
|---|---|
| PubChem CID | 47065380 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-[4-(oxolan-2-ylmethoxy)anilino]propanamide |
| SMILES | CC(Nc1ccc(OCC2CCCO2)cc1)C(=O)NC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H29N3O4/c1-13(17(23)21-18(24)22-19(2,3)4)20-14-7-9-15(10-8-14)26-12-16-6-5-11-25-16/h7-10,13,16,20H,5-6,11-12H2,1-4H3,(H2,21,22,23,24) |
| InChIKey | FLHOBUMWEZKMBB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|