C18H23N3O4 — CID 94642959
(2S)-N-(3-methyl-1,2-oxazol-5-yl)-2-[4-[[(2R)-oxolan-2-yl]methoxy]anilino]propanamide (PubChem CID 94642959) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is (2S)-N-(3-methyl-1,2-oxazol-5-yl)-2-[4-[[(2R)-oxolan-2-yl]methoxy]anilino]propanamide.
| Compound Name | (2S)-N-(3-methyl-1,2-oxazol-5-yl)-2-[4-[[(2R)-oxolan-2-yl]methoxy]anilino]propanamide |
|---|---|
| PubChem CID | 94642959 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S)-N-(3-methyl-1,2-oxazol-5-yl)-2-[4-[[(2R)-oxolan-2-yl]methoxy]anilino]propanamide |
| SMILES | Cc1cc(NC(=O)[C@H](C)Nc2ccc(OC[C@H]3CCCO3)cc2)on1 |
| InChI | InChI=1S/C18H23N3O4/c1-12-10-17(25-21-12)20-18(22)13(2)19-14-5-7-15(8-6-14)24-11-16-4-3-9-23-16/h5-8,10,13,16,19H,3-4,9,11H2,1-2H3,(H,20,22)/t13-,16+/m0/s1 |
| InChIKey | GZUHJEFXQLIVGW-XJKSGUPXSA-N |
| XLogP | 2.98 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|