C23H19NO3 — CID 121347431
2-[2-[[3-(3-cyano-2-methylphenyl)phenyl]methoxy]phenyl]acetic acid (PubChem CID 121347431) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[2-[[3-(3-cyano-2-methylphenyl)phenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-(3-cyano-2-methylphenyl)phenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 121347431 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[2-[[3-(3-cyano-2-methylphenyl)phenyl]methoxy]phenyl]acetic acid |
| SMILES | Cc1c(C#N)cccc1-c1cccc(COc2ccccc2CC(=O)O)c1 |
| InChI | InChI=1S/C23H19NO3/c1-16-20(14-24)9-5-10-21(16)18-8-4-6-17(12-18)15-27-22-11-3-2-7-19(22)13-23(25)26/h2-12H,13,15H2,1H3,(H,25,26) |
| InChIKey | GWWCPBQLMXOKBN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |