C23H22ClNO3 — CID 121347503
2-[2-[[3-[3-(1-aminoethyl)-2-chlorophenyl]phenyl]methoxy]phenyl]acetic acid (PubChem CID 121347503) has the molecular formula C23H22ClNO3 and a molecular weight of 395.89 g/mol. Its IUPAC name is 2-[2-[[3-[3-(1-aminoethyl)-2-chlorophenyl]phenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-[3-(1-aminoethyl)-2-chlorophenyl]phenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 121347503 |
| Molecular Formula | C23H22ClNO3 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[2-[[3-[3-(1-aminoethyl)-2-chlorophenyl]phenyl]methoxy]phenyl]acetic acid |
| SMILES | CC(N)c1cccc(-c2cccc(COc3ccccc3CC(=O)O)c2)c1Cl |
| InChI | InChI=1S/C23H22ClNO3/c1-15(25)19-9-5-10-20(23(19)24)17-8-4-6-16(12-17)14-28-21-11-3-2-7-18(21)13-22(26)27/h2-12,15H,13-14,25H2,1H3,(H,26,27) |
| InChIKey | QNCZHSAJKIIAJG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |