C25H28N2O3 — CID 144778291
2-[2-[[3-[3-(aminomethyl)phenyl]-5-(propan-2-ylamino)phenyl]methoxy]phenyl]acetic acid (PubChem CID 144778291) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[2-[[3-[3-(aminomethyl)phenyl]-5-(propan-2-ylamino)phenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-[3-(aminomethyl)phenyl]-5-(propan-2-ylamino)phenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 144778291 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-[2-[[3-[3-(aminomethyl)phenyl]-5-(propan-2-ylamino)phenyl]methoxy]phenyl]acetic acid |
| SMILES | CC(C)Nc1cc(COc2ccccc2CC(=O)O)cc(-c2cccc(CN)c2)c1 |
| InChI | InChI=1S/C25H28N2O3/c1-17(2)27-23-12-19(11-22(13-23)20-8-5-6-18(10-20)15-26)16-30-24-9-4-3-7-21(24)14-25(28)29/h3-13,17,27H,14-16,26H2,1-2H3,(H,28,29) |
| InChIKey | KGUVRTHZSGFPFV-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |