C30H26N2O3 — CID 139560373
2-[2-[[4-[3-(aminomethyl)phenyl]-1-phenylindol-6-yl]methoxy]phenyl]acetic acid (PubChem CID 139560373) has the molecular formula C30H26N2O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[2-[[4-[3-(aminomethyl)phenyl]-1-phenylindol-6-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[4-[3-(aminomethyl)phenyl]-1-phenylindol-6-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 139560373 |
| Molecular Formula | C30H26N2O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-[2-[[4-[3-(aminomethyl)phenyl]-1-phenylindol-6-yl]methoxy]phenyl]acetic acid |
| SMILES | NCc1cccc(-c2cc(COc3ccccc3CC(=O)O)cc3c2ccn3-c2ccccc2)c1 |
| InChI | InChI=1S/C30H26N2O3/c31-19-21-7-6-9-23(15-21)27-16-22(20-35-29-12-5-4-8-24(29)18-30(33)34)17-28-26(27)13-14-32(28)25-10-2-1-3-11-25/h1-17H,18-20,31H2,(H,33,34) |
| InChIKey | MSWIPMVAFZQZKZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |