C27H28N2O5S — CID 139561576
ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-methylsulfonylindol-6-yl]methoxy]phenyl]acetate (PubChem CID 139561576) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-methylsulfonylindol-6-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-methylsulfonylindol-6-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139561576 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-methylsulfonylindol-6-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(-c2cccc(CN)c2)c2ccn(S(C)(=O)=O)c2c1 |
| InChI | InChI=1S/C27H28N2O5S/c1-3-33-27(30)16-22-8-4-5-10-26(22)34-18-20-14-24(21-9-6-7-19(13-21)17-28)23-11-12-29(25(23)15-20)35(2,31)32/h4-15H,3,16-18,28H2,1-2H3 |
| InChIKey | LYJKYSMTNVJEJI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |