C32H30N2O3 — CID 139561271
ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-phenylindol-6-yl]methoxy]phenyl]acetate (PubChem CID 139561271) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-phenylindol-6-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-phenylindol-6-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139561271 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | ethyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-phenylindol-6-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(-c2cccc(CN)c2)c2ccn(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C32H30N2O3/c1-2-36-32(35)20-26-10-6-7-14-31(26)37-22-24-18-29(25-11-8-9-23(17-25)21-33)28-15-16-34(30(28)19-24)27-12-4-3-5-13-27/h3-19H,2,20-22,33H2,1H3 |
| InChIKey | JZOLABLQJZKNQK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |