C30H34N2O4 — CID 166658021
3-methoxypropyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-methylindol-6-yl]methoxy]-4-methylphenyl]acetate (PubChem CID 166658021) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 3-methoxypropyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-methylindol-6-yl]methoxy]-4-methylphenyl]acetate.
| Compound Name | 3-methoxypropyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-methylindol-6-yl]methoxy]-4-methylphenyl]acetate |
|---|---|
| PubChem CID | 166658021 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 3-methoxypropyl 2-[2-[[4-[3-(aminomethyl)phenyl]-1-methylindol-6-yl]methoxy]-4-methylphenyl]acetate |
| SMILES | COCCCOC(=O)Cc1ccc(C)cc1OCc1cc(-c2cccc(CN)c2)c2ccn(C)c2c1 |
| InChI | InChI=1S/C30H34N2O4/c1-21-8-9-25(18-30(33)35-13-5-12-34-3)29(14-21)36-20-23-16-27(24-7-4-6-22(15-24)19-31)26-10-11-32(2)28(26)17-23/h4,6-11,14-17H,5,12-13,18-20,31H2,1-3H3 |
| InChIKey | LSIZJUGBASUORV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|