C35H44BNO4 — CID 171558633
CID 171558633 (PubChem CID 171558633) has the molecular formula C35H44BNO4 and a molecular weight of 553.55 g/mol.
| Compound Name | CID 171558633 |
|---|---|
| PubChem CID | 171558633 |
| Molecular Formula | C35H44BNO4 |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | — |
| SMILES | C1CCC1.[B]CC(C)CC1CCC1Nc1cc(COc2ccccc2CC(=O)O)cc(-c2cccc(CCO)c2)c1 |
| InChI | InChI=1S/C31H36BNO4.C4H8/c1-21(19-32)13-25-9-10-29(25)33-28-16-23(20-37-30-8-3-2-6-26(30)18-31(35)36)15-27(17-28)24-7-4-5-22(14-24)11-12-34;1-2-4-3-1/h2-8,14-17,21,25,29,33-34H,9-13,18-20H2,1H3,(H,35,36);1-4H2 |
| InChIKey | XCAHNCFVWQDUOO-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|