C21H14F3N3 — CID 121349974
6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]quinoline (PubChem CID 121349974) has the molecular formula C21H14F3N3 and a molecular weight of 365.36 g/mol. Its IUPAC name is 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]quinoline.
| Compound Name | 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]quinoline |
|---|---|
| PubChem CID | 121349974 |
| Molecular Formula | C21H14F3N3 |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]quinoline |
| SMILES | Fc1cc(F)c(F)c(-c2nc3n(c2-c2ccc4ncccc4c2)CCC3)c1 |
| InChI | InChI=1S/C21H14F3N3/c22-14-10-15(19(24)16(23)11-14)20-21(27-8-2-4-18(27)26-20)13-5-6-17-12(9-13)3-1-7-25-17/h1,3,5-7,9-11H,2,4,8H2 |
| InChIKey | OCPMOPMETPLFFF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|