C20H13F3N4 — CID 121350047
6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]quinoxaline (PubChem CID 121350047) has the molecular formula C20H13F3N4 and a molecular weight of 366.35 g/mol. Its IUPAC name is 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]quinoxaline.
| Compound Name | 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]quinoxaline |
|---|---|
| PubChem CID | 121350047 |
| Molecular Formula | C20H13F3N4 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 6-[2-(2,3,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl]quinoxaline |
| SMILES | Fc1cc(F)c(F)c(-c2nc3n(c2-c2ccc4nccnc4c2)CCC3)c1 |
| InChI | InChI=1S/C20H13F3N4/c21-12-9-13(18(23)14(22)10-12)19-20(27-7-1-2-17(27)26-19)11-3-4-15-16(8-11)25-6-5-24-15/h3-6,8-10H,1-2,7H2 |
| InChIKey | MGOKKFDXPBBOLS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|