C11H14ClN3 — CID 121350736
(9S)-5-chloro-3,4-dimethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 121350736) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is (9S)-5-chloro-3,4-dimethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (9S)-5-chloro-3,4-dimethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 121350736 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | (9S)-5-chloro-3,4-dimethyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | Cc1c(Cl)nc2c(c1C)N1CC[C@@H](C1)N2 |
| InChI | InChI=1S/C11H14ClN3/c1-6-7(2)10(12)14-11-9(6)15-4-3-8(5-15)13-11/h8H,3-5H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | AXMFHOZTWMCIMQ-QMMMGPOBSA-N |
| XLogP | 2.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|