C17H20N4 — CID 121350754
(9S)-3,4-dimethyl-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 121350754) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is (9S)-3,4-dimethyl-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (9S)-3,4-dimethyl-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 121350754 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (9S)-3,4-dimethyl-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | Cc1cc(-c2nc3c(c(C)c2C)N2CC[C@@H](C2)N3)ccn1 |
| InChI | InChI=1S/C17H20N4/c1-10-8-13(4-6-18-10)15-11(2)12(3)16-17(20-15)19-14-5-7-21(16)9-14/h4,6,8,14H,5,7,9H2,1-3H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | SLQPWOVZSRZKBR-AWEZNQCLSA-N |
| XLogP | 3.07 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |