C17H25NO4 — CID 121353408
N-[2-[3,4-bis(hydroxymethyl)phenoxy]ethyl]-2-cyclopentylacetamide (PubChem CID 121353408) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-[2-[3,4-bis(hydroxymethyl)phenoxy]ethyl]-2-cyclopentylacetamide.
| Compound Name | N-[2-[3,4-bis(hydroxymethyl)phenoxy]ethyl]-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 121353408 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | N-[2-[3,4-bis(hydroxymethyl)phenoxy]ethyl]-2-cyclopentylacetamide |
| SMILES | O=C(CC1CCCC1)NCCOc1ccc(CO)c(CO)c1 |
| InChI | InChI=1S/C17H25NO4/c19-11-14-5-6-16(10-15(14)12-20)22-8-7-18-17(21)9-13-3-1-2-4-13/h5-6,10,13,19-20H,1-4,7-9,11-12H2,(H,18,21) |
| InChIKey | YSYFMIAVNFRONG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|