C27H26F2N6O2 — CID 121360955
3-[(7R)-2-(3,5-difluoro-4-hydroxyanilino)-7-methyl-8-(4-methylcyclohexyl)-6-oxo-7H-pteridin-5-yl]benzonitrile (PubChem CID 121360955) has the molecular formula C27H26F2N6O2 and a molecular weight of 504.54 g/mol. Its IUPAC name is 3-[(7R)-2-(3,5-difluoro-4-hydroxyanilino)-7-methyl-8-(4-methylcyclohexyl)-6-oxo-7H-pteridin-5-yl]benzonitrile.
| Compound Name | 3-[(7R)-2-(3,5-difluoro-4-hydroxyanilino)-7-methyl-8-(4-methylcyclohexyl)-6-oxo-7H-pteridin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 121360955 |
| Molecular Formula | C27H26F2N6O2 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 3-[(7R)-2-(3,5-difluoro-4-hydroxyanilino)-7-methyl-8-(4-methylcyclohexyl)-6-oxo-7H-pteridin-5-yl]benzonitrile |
| SMILES | CC1CCC(N2c3nc(Nc4cc(F)c(O)c(F)c4)ncc3N(c3cccc(C#N)c3)C(=O)[C@H]2C)CC1 |
| InChI | InChI=1S/C27H26F2N6O2/c1-15-6-8-19(9-7-15)34-16(2)26(37)35(20-5-3-4-17(10-20)13-30)23-14-31-27(33-25(23)34)32-18-11-21(28)24(36)22(29)12-18/h3-5,10-12,14-16,19,36H,6-9H2,1-2H3,(H,31,32,33)/t15?,16-,19?/m1/s1 |
| InChIKey | HOZQGQYDCGBSGT-KOHRHEQBSA-N |
| XLogP | 5.53 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|