C30H33FN8O2 — CID 71566533
(7R)-8-cyclohexyl-2-[(7-fluoro-1H-indazol-5-yl)amino]-7-methyl-5-(4-morpholin-4-ylphenyl)-7H-pteridin-6-one (PubChem CID 71566533) has the molecular formula C30H33FN8O2 and a molecular weight of 556.65 g/mol. Its IUPAC name is (7R)-8-cyclohexyl-2-[(7-fluoro-1H-indazol-5-yl)amino]-7-methyl-5-(4-morpholin-4-ylphenyl)-7H-pteridin-6-one.
| Compound Name | (7R)-8-cyclohexyl-2-[(7-fluoro-1H-indazol-5-yl)amino]-7-methyl-5-(4-morpholin-4-ylphenyl)-7H-pteridin-6-one |
|---|---|
| PubChem CID | 71566533 |
| Molecular Formula | C30H33FN8O2 |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | (7R)-8-cyclohexyl-2-[(7-fluoro-1H-indazol-5-yl)amino]-7-methyl-5-(4-morpholin-4-ylphenyl)-7H-pteridin-6-one |
| SMILES | C[C@@H]1C(=O)N(c2ccc(N3CCOCC3)cc2)c2cnc(Nc3cc(F)c4[nH]ncc4c3)nc2N1C1CCCCC1 |
| InChI | InChI=1S/C30H33FN8O2/c1-19-29(40)39(24-9-7-22(8-10-24)37-11-13-41-14-12-37)26-18-32-30(35-28(26)38(19)23-5-3-2-4-6-23)34-21-15-20-17-33-36-27(20)25(31)16-21/h7-10,15-19,23H,2-6,11-14H2,1H3,(H,33,36)(H,32,34,35)/t19-/m1/s1 |
| InChIKey | BEOLMKJTKMZFIQ-LJQANCHMSA-N |
| XLogP | 5.28 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|