C24H26F2N6O2 — CID 137104033
(7R)-8-cyclohexyl-2-(3,5-difluoro-4-hydroxyanilino)-7-methyl-5-pyridin-3-yl-6,7-dihydro-3H-pteridin-4-one (PubChem CID 137104033) has the molecular formula C24H26F2N6O2 and a molecular weight of 468.51 g/mol. Its IUPAC name is (7R)-8-cyclohexyl-2-(3,5-difluoro-4-hydroxyanilino)-7-methyl-5-pyridin-3-yl-6,7-dihydro-3H-pteridin-4-one.
| Compound Name | (7R)-8-cyclohexyl-2-(3,5-difluoro-4-hydroxyanilino)-7-methyl-5-pyridin-3-yl-6,7-dihydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 137104033 |
| Molecular Formula | C24H26F2N6O2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | (7R)-8-cyclohexyl-2-(3,5-difluoro-4-hydroxyanilino)-7-methyl-5-pyridin-3-yl-6,7-dihydro-3H-pteridin-4-one |
| SMILES | C[C@@H]1CN(c2cccnc2)c2c(nc(Nc3cc(F)c(O)c(F)c3)[nH]c2=O)N1C1CCCCC1 |
| InChI | InChI=1S/C24H26F2N6O2/c1-14-13-31(17-8-5-9-27-12-17)20-22(32(14)16-6-3-2-4-7-16)29-24(30-23(20)34)28-15-10-18(25)21(33)19(26)11-15/h5,8-12,14,16,33H,2-4,6-7,13H2,1H3,(H2,28,29,30,34)/t14-/m1/s1 |
| InChIKey | CLKFLUCIIVAGRZ-CQSZACIVSA-N |
| XLogP | 4.57 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|