C24H28N2O3S — CID 121366680
1-[3-(3-aminophenyl)sulfonylanilino]-3-(2,4,6-trimethylphenyl)propan-2-ol (PubChem CID 121366680) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-[3-(3-aminophenyl)sulfonylanilino]-3-(2,4,6-trimethylphenyl)propan-2-ol.
| Compound Name | 1-[3-(3-aminophenyl)sulfonylanilino]-3-(2,4,6-trimethylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 121366680 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-[3-(3-aminophenyl)sulfonylanilino]-3-(2,4,6-trimethylphenyl)propan-2-ol |
| SMILES | Cc1cc(C)c(CC(O)CNc2cccc(S(=O)(=O)c3cccc(N)c3)c2)c(C)c1 |
| InChI | InChI=1S/C24H28N2O3S/c1-16-10-17(2)24(18(3)11-16)14-21(27)15-26-20-7-5-9-23(13-20)30(28,29)22-8-4-6-19(25)12-22/h4-13,21,26-27H,14-15,25H2,1-3H3 |
| InChIKey | MJNJLTAJGPHKGP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|