C27H34O4 — CID 121368029
methyl 2-[3-butoxy-2-(3,4-dihydro-2H-chromen-6-yl)-6-methylphenyl]-3-cyclopropylpropanoate (PubChem CID 121368029) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is methyl 2-[3-butoxy-2-(3,4-dihydro-2H-chromen-6-yl)-6-methylphenyl]-3-cyclopropylpropanoate.
| Compound Name | methyl 2-[3-butoxy-2-(3,4-dihydro-2H-chromen-6-yl)-6-methylphenyl]-3-cyclopropylpropanoate |
|---|---|
| PubChem CID | 121368029 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | methyl 2-[3-butoxy-2-(3,4-dihydro-2H-chromen-6-yl)-6-methylphenyl]-3-cyclopropylpropanoate |
| SMILES | CCCCOc1ccc(C)c(C(CC2CC2)C(=O)OC)c1-c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C27H34O4/c1-4-5-14-31-24-12-8-18(2)25(22(27(28)29-3)16-19-9-10-19)26(24)21-11-13-23-20(17-21)7-6-15-30-23/h8,11-13,17,19,22H,4-7,9-10,14-16H2,1-3H3 |
| InChIKey | QCXIJLVJMNGTKK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|