C13H22F2O — CID 121372564
2-[(1S)-2,3-difluoro-4-methylcyclohexyl]-5-methyloxane (PubChem CID 121372564) has the molecular formula C13H22F2O and a molecular weight of 232.31 g/mol. Its IUPAC name is 2-[(1S)-2,3-difluoro-4-methylcyclohexyl]-5-methyloxane.
| Compound Name | 2-[(1S)-2,3-difluoro-4-methylcyclohexyl]-5-methyloxane |
|---|---|
| PubChem CID | 121372564 |
| Molecular Formula | C13H22F2O |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-[(1S)-2,3-difluoro-4-methylcyclohexyl]-5-methyloxane |
| SMILES | CC1CCC([C@@H]2CCC(C)C(F)C2F)OC1 |
| InChI | InChI=1S/C13H22F2O/c1-8-3-6-11(16-7-8)10-5-4-9(2)12(14)13(10)15/h8-13H,3-7H2,1-2H3/t8?,9?,10-,11?,12?,13?/m0/s1 |
| InChIKey | JVXGYRKOIDLOHF-GGEAOBHFSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |