C17H15FN2O4 — CID 121374175
2-(2-fluoro-4-methoxyphenyl)-3,4-dimethoxyquinazolin-5-one (PubChem CID 121374175) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is 2-(2-fluoro-4-methoxyphenyl)-3,4-dimethoxyquinazolin-5-one.
| Compound Name | 2-(2-fluoro-4-methoxyphenyl)-3,4-dimethoxyquinazolin-5-one |
|---|---|
| PubChem CID | 121374175 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(2-fluoro-4-methoxyphenyl)-3,4-dimethoxyquinazolin-5-one |
| SMILES | COc1ccc(-c2nc3cccc(=O)c-3c(OC)n2OC)c(F)c1 |
| InChI | InChI=1S/C17H15FN2O4/c1-22-10-7-8-11(12(18)9-10)16-19-13-5-4-6-14(21)15(13)17(23-2)20(16)24-3/h4-9H,1-3H3 |
| InChIKey | LGXMRMNWHIDNHC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |