C14H8F5NO2 — CID 121375011
[2-(3,5-difluorophenyl)-4-(trifluoromethyl)phenyl] carbamate (PubChem CID 121375011) has the molecular formula C14H8F5NO2 and a molecular weight of 317.21 g/mol. Its IUPAC name is [2-(3,5-difluorophenyl)-4-(trifluoromethyl)phenyl] carbamate.
| Compound Name | [2-(3,5-difluorophenyl)-4-(trifluoromethyl)phenyl] carbamate |
|---|---|
| PubChem CID | 121375011 |
| Molecular Formula | C14H8F5NO2 |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [2-(3,5-difluorophenyl)-4-(trifluoromethyl)phenyl] carbamate |
| SMILES | NC(=O)Oc1ccc(C(F)(F)F)cc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H8F5NO2/c15-9-3-7(4-10(16)6-9)11-5-8(14(17,18)19)1-2-12(11)22-13(20)21/h1-6H,(H2,20,21) |
| InChIKey | FKVXCQLRDLGUHV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |