C15H11F4NO — CID 46212198
2-[2-(3-fluorophenyl)-4-(trifluoromethyl)phenyl]acetamide (PubChem CID 46212198) has the molecular formula C15H11F4NO and a molecular weight of 297.25 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[2-(3-fluorophenyl)-4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 46212198 |
| Molecular Formula | C15H11F4NO |
| Molecular Weight | 297.25 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-4-(trifluoromethyl)phenyl]acetamide |
| SMILES | NC(=O)Cc1ccc(C(F)(F)F)cc1-c1cccc(F)c1 |
| InChI | InChI=1S/C15H11F4NO/c16-12-3-1-2-9(6-12)13-8-11(15(17,18)19)5-4-10(13)7-14(20)21/h1-6,8H,7H2,(H2,20,21) |
| InChIKey | NZNYTALJGMAGPZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |