C16H13Cl2FN2O6 — CID 121375195
[4-acetamido-3-chloro-6-[4-chloro-2-fluoro-3-(methoxymethoxy)phenyl]-2-pyridinyl] hydrogen carbonate (PubChem CID 121375195) has the molecular formula C16H13Cl2FN2O6 and a molecular weight of 419.19 g/mol. Its IUPAC name is [4-acetamido-3-chloro-6-[4-chloro-2-fluoro-3-(methoxymethoxy)phenyl]-2-pyridinyl] hydrogen carbonate.
| Compound Name | [4-acetamido-3-chloro-6-[4-chloro-2-fluoro-3-(methoxymethoxy)phenyl]-2-pyridinyl] hydrogen carbonate |
|---|---|
| PubChem CID | 121375195 |
| Molecular Formula | C16H13Cl2FN2O6 |
| Molecular Weight | 419.19 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | [4-acetamido-3-chloro-6-[4-chloro-2-fluoro-3-(methoxymethoxy)phenyl]-2-pyridinyl] hydrogen carbonate |
| SMILES | COCOc1c(Cl)ccc(-c2cc(NC(C)=O)c(Cl)c(OC(=O)O)n2)c1F |
| InChI | InChI=1S/C16H13Cl2FN2O6/c1-7(22)20-11-5-10(21-15(12(11)18)27-16(23)24)8-3-4-9(17)14(13(8)19)26-6-25-2/h3-5H,6H2,1-2H3,(H,23,24)(H,20,21,22) |
| InChIKey | LCFREZUUANTMFJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|