C14H8Cl2FN3O3 — CID 68648426
[4-amino-3-chloro-6-(4-chloro-3-cyano-2-fluorophenyl)-2-pyridinyl] methyl carbonate (PubChem CID 68648426) has the molecular formula C14H8Cl2FN3O3 and a molecular weight of 356.14 g/mol. Its IUPAC name is [4-amino-3-chloro-6-(4-chloro-3-cyano-2-fluorophenyl)-2-pyridinyl] methyl carbonate.
| Compound Name | [4-amino-3-chloro-6-(4-chloro-3-cyano-2-fluorophenyl)-2-pyridinyl] methyl carbonate |
|---|---|
| PubChem CID | 68648426 |
| Molecular Formula | C14H8Cl2FN3O3 |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | [4-amino-3-chloro-6-(4-chloro-3-cyano-2-fluorophenyl)-2-pyridinyl] methyl carbonate |
| SMILES | COC(=O)Oc1nc(-c2ccc(Cl)c(C#N)c2F)cc(N)c1Cl |
| InChI | InChI=1S/C14H8Cl2FN3O3/c1-22-14(21)23-13-11(16)9(19)4-10(20-13)6-2-3-8(15)7(5-18)12(6)17/h2-4H,1H3,(H2,19,20) |
| InChIKey | MOEIPMVYPXHZIK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |