C12H9Cl2N3O3 — CID 67974691
[4-amino-6-(2-amino-4-chlorophenyl)-3-chloro-2-pyridinyl] hydrogen carbonate (PubChem CID 67974691) has the molecular formula C12H9Cl2N3O3 and a molecular weight of 314.13 g/mol. Its IUPAC name is [4-amino-6-(2-amino-4-chlorophenyl)-3-chloro-2-pyridinyl] hydrogen carbonate.
| Compound Name | [4-amino-6-(2-amino-4-chlorophenyl)-3-chloro-2-pyridinyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67974691 |
| Molecular Formula | C12H9Cl2N3O3 |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | [4-amino-6-(2-amino-4-chlorophenyl)-3-chloro-2-pyridinyl] hydrogen carbonate |
| SMILES | Nc1cc(Cl)ccc1-c1cc(N)c(Cl)c(OC(=O)O)n1 |
| InChI | InChI=1S/C12H9Cl2N3O3/c13-5-1-2-6(7(15)3-5)9-4-8(16)10(14)11(17-9)20-12(18)19/h1-4H,15H2,(H2,16,17)(H,18,19) |
| InChIKey | IEMHQAPUCNQKIE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 111.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|