C27H33F3N4O2 — CID 121379729
[8-[[(1-cyclopropyl-2,2,2-trifluoroethyl)-methylamino]methyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone (PubChem CID 121379729) has the molecular formula C27H33F3N4O2 and a molecular weight of 502.58 g/mol. Its IUPAC name is [8-[[(1-cyclopropyl-2,2,2-trifluoroethyl)-methylamino]methyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone.
| Compound Name | [8-[[(1-cyclopropyl-2,2,2-trifluoroethyl)-methylamino]methyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone |
|---|---|
| PubChem CID | 121379729 |
| Molecular Formula | C27H33F3N4O2 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [8-[[(1-cyclopropyl-2,2,2-trifluoroethyl)-methylamino]methyl]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-(4-methoxycyclohexyl)methanone |
| SMILES | COC1CCC(C(=O)N2Cc3cccnc3Nc3ccc(CN(C)C(C4CC4)C(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C27H33F3N4O2/c1-33(24(18-6-7-18)27(28,29)30)15-17-5-12-22-23(14-17)34(16-20-4-3-13-31-25(20)32-22)26(35)19-8-10-21(36-2)11-9-19/h3-5,12-14,18-19,21,24H,6-11,15-16H2,1-2H3,(H,31,32) |
| InChIKey | FEFCSXKHXSPMCY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |