C23H27N3O5 — CID 121379762
ditert-butyl 8-formyl-5H-pyrido[3,2-c][1,5]benzodiazepine-6,11-dicarboxylate (PubChem CID 121379762) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is ditert-butyl 8-formyl-5H-pyrido[3,2-c][1,5]benzodiazepine-6,11-dicarboxylate.
| Compound Name | ditert-butyl 8-formyl-5H-pyrido[3,2-c][1,5]benzodiazepine-6,11-dicarboxylate |
|---|---|
| PubChem CID | 121379762 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | ditert-butyl 8-formyl-5H-pyrido[3,2-c][1,5]benzodiazepine-6,11-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cccnc2N(C(=O)OC(C)(C)C)c2ccc(C=O)cc21 |
| InChI | InChI=1S/C23H27N3O5/c1-22(2,3)30-20(28)25-13-16-8-7-11-24-19(16)26(21(29)31-23(4,5)6)17-10-9-15(14-27)12-18(17)25/h7-12,14H,13H2,1-6H3 |
| InChIKey | SKFVBXVYRLACEO-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|