C25H32N4O7 — CID 121383239
ditert-butyl 8-(1-hydroxy-2-nitropropyl)-5H-pyrido[3,2-c][1,5]benzodiazepine-6,11-dicarboxylate (PubChem CID 121383239) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is ditert-butyl 8-(1-hydroxy-2-nitropropyl)-5H-pyrido[3,2-c][1,5]benzodiazepine-6,11-dicarboxylate.
| Compound Name | ditert-butyl 8-(1-hydroxy-2-nitropropyl)-5H-pyrido[3,2-c][1,5]benzodiazepine-6,11-dicarboxylate |
|---|---|
| PubChem CID | 121383239 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | ditert-butyl 8-(1-hydroxy-2-nitropropyl)-5H-pyrido[3,2-c][1,5]benzodiazepine-6,11-dicarboxylate |
| SMILES | CC(C(O)c1ccc2c(c1)N(C(=O)OC(C)(C)C)Cc1cccnc1N2C(=O)OC(C)(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C25H32N4O7/c1-15(29(33)34)20(30)16-10-11-18-19(13-16)27(22(31)35-24(2,3)4)14-17-9-8-12-26-21(17)28(18)23(32)36-25(5,6)7/h8-13,15,20,30H,14H2,1-7H3 |
| InChIKey | SYLAYURRCRGXBI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 135.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|