C19H16F2N6O4 — CID 121381946
2,3,4,6-tetraamino-N-[5-(2,2-difluoro-6-hydroxy-1,3-benzodioxol-5-yl)-2-pyridinyl]benzamide (PubChem CID 121381946) has the molecular formula C19H16F2N6O4 and a molecular weight of 430.37 g/mol. Its IUPAC name is 2,3,4,6-tetraamino-N-[5-(2,2-difluoro-6-hydroxy-1,3-benzodioxol-5-yl)-2-pyridinyl]benzamide.
| Compound Name | 2,3,4,6-tetraamino-N-[5-(2,2-difluoro-6-hydroxy-1,3-benzodioxol-5-yl)-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 121381946 |
| Molecular Formula | C19H16F2N6O4 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2,3,4,6-tetraamino-N-[5-(2,2-difluoro-6-hydroxy-1,3-benzodioxol-5-yl)-2-pyridinyl]benzamide |
| SMILES | Nc1cc(N)c(C(=O)Nc2ccc(-c3cc4c(cc3O)OC(F)(F)O4)cn2)c(N)c1N |
| InChI | InChI=1S/C19H16F2N6O4/c20-19(21)30-12-3-8(11(28)5-13(12)31-19)7-1-2-14(26-6-7)27-18(29)15-9(22)4-10(23)16(24)17(15)25/h1-6,28H,22-25H2,(H,26,27,29) |
| InChIKey | ADCPFAJZWLFBCP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 184.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|