C13H6F3N3O5 — CID 178008845
2,2-difluoro-N-(5-fluoro-2-pyridinyl)-6-nitro-1,3-benzodioxole-5-carboxamide (PubChem CID 178008845) has the molecular formula C13H6F3N3O5 and a molecular weight of 341.20 g/mol. Its IUPAC name is 2,2-difluoro-N-(5-fluoro-2-pyridinyl)-6-nitro-1,3-benzodioxole-5-carboxamide.
| Compound Name | 2,2-difluoro-N-(5-fluoro-2-pyridinyl)-6-nitro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 178008845 |
| Molecular Formula | C13H6F3N3O5 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2,2-difluoro-N-(5-fluoro-2-pyridinyl)-6-nitro-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)cn1)c1cc2c(cc1[N+](=O)[O-])OC(F)(F)O2 |
| InChI | InChI=1S/C13H6F3N3O5/c14-6-1-2-11(17-5-6)18-12(20)7-3-9-10(4-8(7)19(21)22)24-13(15,16)23-9/h1-5H,(H,17,18,20) |
| InChIKey | ROFOUWWGPJKBFK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|