C14H7F2N5O5 — CID 178008846
2,2-difluoro-6-nitro-N-([1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 178008846) has the molecular formula C14H7F2N5O5 and a molecular weight of 363.24 g/mol. Its IUPAC name is 2,2-difluoro-6-nitro-N-([1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 2,2-difluoro-6-nitro-N-([1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 178008846 |
| Molecular Formula | C14H7F2N5O5 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2,2-difluoro-6-nitro-N-([1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccn2ncnc2c1)c1cc2c(cc1[N+](=O)[O-])OC(F)(F)O2 |
| InChI | InChI=1S/C14H7F2N5O5/c15-14(16)25-10-4-8(9(21(23)24)5-11(10)26-14)13(22)19-7-1-2-20-12(3-7)17-6-18-20/h1-6H,(H,19,22) |
| InChIKey | FPNXPNDEXUYQTC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|