C16H10F4N4O9 — CID 162216483
2,2-difluoro-6-nitro-1,3-benzodioxol-5-amine;N-(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)acetamide (PubChem CID 162216483) has the molecular formula C16H10F4N4O9 and a molecular weight of 478.27 g/mol. Its IUPAC name is 2,2-difluoro-6-nitro-1,3-benzodioxol-5-amine;N-(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2,2-difluoro-6-nitro-1,3-benzodioxol-5-amine;N-(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 162216483 |
| Molecular Formula | C16H10F4N4O9 |
| Molecular Weight | 478.27 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 2,2-difluoro-6-nitro-1,3-benzodioxol-5-amine;N-(2,2-difluoro-6-nitro-1,3-benzodioxol-5-yl)acetamide |
| SMILES | CC(=O)Nc1cc2c(cc1[N+](=O)[O-])OC(F)(F)O2.Nc1cc2c(cc1[N+](=O)[O-])OC(F)(F)O2 |
| InChI | InChI=1S/C9H6F2N2O5.C7H4F2N2O4/c1-4(14)12-5-2-7-8(3-6(5)13(15)16)18-9(10,11)17-7;8-7(9)14-5-1-3(10)4(11(12)13)2-6(5)15-7/h2-3H,1H3,(H,12,14);1-2H,10H2 |
| InChIKey | PAMBXOUFYSCUGE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 178.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|