C13H11F2N3O5 — CID 178008811
N-(1-cyano-2-methylpropan-2-yl)-2,2-difluoro-6-nitro-1,3-benzodioxole-5-carboxamide (PubChem CID 178008811) has the molecular formula C13H11F2N3O5 and a molecular weight of 327.24 g/mol. Its IUPAC name is N-(1-cyano-2-methylpropan-2-yl)-2,2-difluoro-6-nitro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(1-cyano-2-methylpropan-2-yl)-2,2-difluoro-6-nitro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 178008811 |
| Molecular Formula | C13H11F2N3O5 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-(1-cyano-2-methylpropan-2-yl)-2,2-difluoro-6-nitro-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)(CC#N)NC(=O)c1cc2c(cc1[N+](=O)[O-])OC(F)(F)O2 |
| InChI | InChI=1S/C13H11F2N3O5/c1-12(2,3-4-16)17-11(19)7-5-9-10(6-8(7)18(20)21)23-13(14,15)22-9/h5-6H,3H2,1-2H3,(H,17,19) |
| InChIKey | IVQAQIFTDQXLBI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|