C17H11F2NO7 — CID 162538495
methyl 3-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-nitrophenyl]-2-oxopropanoate (PubChem CID 162538495) has the molecular formula C17H11F2NO7 and a molecular weight of 379.27 g/mol. Its IUPAC name is methyl 3-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-nitrophenyl]-2-oxopropanoate.
| Compound Name | methyl 3-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-nitrophenyl]-2-oxopropanoate |
|---|---|
| PubChem CID | 162538495 |
| Molecular Formula | C17H11F2NO7 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | methyl 3-[4-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-nitrophenyl]-2-oxopropanoate |
| SMILES | COC(=O)C(=O)Cc1ccc(-c2ccc3c(c2)OC(F)(F)O3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11F2NO7/c1-25-16(22)13(21)7-11-3-2-9(6-12(11)20(23)24)10-4-5-14-15(8-10)27-17(18,19)26-14/h2-6,8H,7H2,1H3 |
| InChIKey | UOUCZEBMROUJFT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|